What is the molecular weight of p-cresol?
108.14 g/mol
Cresol/Molar mass
What is the formula of P-cresol?
C7H8O
p-Cresol/Formula
What is the structure of para cresol?
Cresol/Formula
What is Cresol BP?
Cresol
| Isomers of Cresol | ||
|---|---|---|
| Melting point | 29.8 °C (303.0 K) | 35.5 °C (309.7 K) |
| Boiling point | 191.0 °C (464.2 K) | 201.9 °C (475.1 K) |
| Acidity (pKa) | 10.287 | 10.26 |
| Viscosity | solid at 25 °C | solid at 25 °C |
What is the density of p-Cresol?
1.03 g/cm³
p-Cresol/Density
Is p-Cresol polar or non polar?
The relatively large dipole moments suggested that all three compounds were non-polar and the order of the polarity was found to be ammonia > butyric acid > p-cresol.
What is the Iupac name of p-Cresol?
4-methylphenol
| IUPAC Name | 4-methylphenol |
|---|---|
| Alternative Names | P-CRESOL 4-Methylphenol 4-Cresol 4-Hydroxytoluene p-Methylphenol |
| Molecular Formula | C7H8O |
| Molar Mass | 108.14 g/mol |
| InChI | InChI=1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3 |
What is another name for p-Cresol?
4-Methylbenzenol
p-Cresol
| Names | |
|---|---|
| Systematic IUPAC name 4-Methylbenzenol | |
| Other names 4-Cresol p-Cresol 3-Hydroxytoluene p-Cresylic acid 1-Hydroxy-4-methylbenzene | |
| Identifiers | |
| CAS Number | 106-44-5 |
What is cresol used for?
Cresol is a methyl phenol with meta, ortho, and para isomers. It is used as a disinfectant and antiseptic. Creosote is a mixture of phenols consisting mainly of cresol and guiacol. It is used as a household remedy for coughs and is found in many proprietary preparations.
Is p-Cresol volatile?
Introduction. p-Cresol (4-methylphenol), a 108.1 Da volatile low-molecular-weight compound, is a member of the large family of the phenoles. It is a partially lipophilic moiety which strongly binds to plasma protein (close to 100%) under normal conditions.
What is cresol used in?
Mixtures of cresols are used as solvents for synthetic resin coatings such as wire enamels, metal degreasers, cutting oils, and agents to remove carbon deposits from combustion engines. Other uses of cresol mixtures include ore flotation and fiber treatment.
What is naphthol used for?
The compound 1-naphthol, or α-naphthol, made by heating 1-naphthalenesulfonic acid with caustic alkali or by heating 1-naphthylamine with water under pressure, is used directly in making several dyes, and large amounts of it are converted to compounds ultimately incorporated into other dyes.
What is the formula for para-cresol?
(Redirected from P-cresol) para-Cresol, also 4-methylphenol, is an organic compound with the formula CH 3 C 6 H 4 (OH). It is a colourless solid that is widely used intermediate in the production of other chemicals. It is a derivative of phenol and is an isomer of o -cresol and m -cresol.
What is the structure of p-cresol?
P-cresol is a cresol that consists of toluene substituted by a hydroxy group at position 4. It is a metabolite of aromatic amino acid metabolism produced by intestinal microflora in humans and animals. It has a role as a uremic toxin, a human metabolite and an Escherichia coli metabolite.
What is a cresol in biology?
A cresol that consists of toluene substituted by a hydroxy group at position 4. It is a metabolite of aromatic amino acid metabolism produced by intestinal microflora in humans and animals. ChEBI CHEBI:17847, https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:17847
What is polyp-cresol used for?
p-Cresol is consumed mainly in the production of antioxidants, e.g., butylated hydroxytoluene (BHT). The monoalkylated derivatives undergo coupling to give an extensive family of diphenol antioxidants.